C23H26N2O5 — CID 42521512
3-(1,3-benzodioxol-5-yl)-1-[(3R)-3-(2,3-dihydro-1,4-benzodioxin-6-ylamino)piperidin-1-yl]propan-1-one (PubChem CID 42521512) has the molecular formula C23H26N2O5 and a molecular weight of 410.47 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-yl)-1-[(3R)-3-(2,3-dihydro-1,4-benzodioxin-6-ylamino)piperidin-1-yl]propan-1-one.
| Compound Name | 3-(1,3-benzodioxol-5-yl)-1-[(3R)-3-(2,3-dihydro-1,4-benzodioxin-6-ylamino)piperidin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 42521512 |
| Molecular Formula | C23H26N2O5 |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.18 |
| IUPAC Name | 3-(1,3-benzodioxol-5-yl)-1-[(3R)-3-(2,3-dihydro-1,4-benzodioxin-6-ylamino)piperidin-1-yl]propan-1-one |
| SMILES | O=C(CCc1ccc2c(c1)OCO2)N1CCC[C@@H](Nc2ccc3c(c2)OCCO3)C1 |
| InChI | InChI=1S/C23H26N2O5/c26-23(8-4-16-3-6-20-21(12-16)30-15-29-20)25-9-1-2-18(14-25)24-17-5-7-19-22(13-17)28-11-10-27-19/h3,5-7,12-13,18,24H,1-2,4,8-11,14-15H2/t18-/m1/s1 |
| InChIKey | BOFJRKDYOFXGCB-GOSISDBHSA-N |
| XLogP | 3.22 |
| TPSA | 69.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|