C17H22N6O3 — CID 45193328
1-[3-(2,3-dihydro-1,4-benzodioxin-6-ylamino)piperidin-1-yl]-3-(tetrazol-1-yl)propan-1-one (PubChem CID 45193328) has the molecular formula C17H22N6O3 and a molecular weight of 358.40 g/mol. Its IUPAC name is 1-[3-(2,3-dihydro-1,4-benzodioxin-6-ylamino)piperidin-1-yl]-3-(tetrazol-1-yl)propan-1-one.
| Compound Name | 1-[3-(2,3-dihydro-1,4-benzodioxin-6-ylamino)piperidin-1-yl]-3-(tetrazol-1-yl)propan-1-one |
|---|---|
| PubChem CID | 45193328 |
| Molecular Formula | C17H22N6O3 |
| Molecular Weight | 358.40 g/mol |
| Exact Mass | 358.18 |
| IUPAC Name | 1-[3-(2,3-dihydro-1,4-benzodioxin-6-ylamino)piperidin-1-yl]-3-(tetrazol-1-yl)propan-1-one |
| SMILES | O=C(CCn1cnnn1)N1CCCC(Nc2ccc3c(c2)OCCO3)C1 |
| InChI | InChI=1S/C17H22N6O3/c24-17(5-7-23-12-18-20-21-23)22-6-1-2-14(11-22)19-13-3-4-15-16(10-13)26-9-8-25-15/h3-4,10,12,14,19H,1-2,5-9,11H2 |
| InChIKey | QBACGISFSUTOCT-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 94.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.40 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|