C20H24N4O3 — CID 42526180
[(3S)-3-(2,3-dihydro-1,4-benzodioxin-6-ylamino)piperidin-1-yl]-(2,6-dimethylpyrimidin-4-yl)methanone (PubChem CID 42526180) has the molecular formula C20H24N4O3 and a molecular weight of 368.44 g/mol. Its IUPAC name is [(3S)-3-(2,3-dihydro-1,4-benzodioxin-6-ylamino)piperidin-1-yl]-(2,6-dimethylpyrimidin-4-yl)methanone.
| Compound Name | [(3S)-3-(2,3-dihydro-1,4-benzodioxin-6-ylamino)piperidin-1-yl]-(2,6-dimethylpyrimidin-4-yl)methanone |
|---|---|
| PubChem CID | 42526180 |
| Molecular Formula | C20H24N4O3 |
| Molecular Weight | 368.44 g/mol |
| Exact Mass | 368.18 |
| IUPAC Name | [(3S)-3-(2,3-dihydro-1,4-benzodioxin-6-ylamino)piperidin-1-yl]-(2,6-dimethylpyrimidin-4-yl)methanone |
| SMILES | Cc1cc(C(=O)N2CCC[C@H](Nc3ccc4c(c3)OCCO4)C2)nc(C)n1 |
| InChI | InChI=1S/C20H24N4O3/c1-13-10-17(22-14(2)21-13)20(25)24-7-3-4-16(12-24)23-15-5-6-18-19(11-15)27-9-8-26-18/h5-6,10-11,16,23H,3-4,7-9,12H2,1-2H3/t16-/m0/s1 |
| InChIKey | GUPXJNAHVGETPW-INIZCTEOSA-N |
| XLogP | 2.58 |
| TPSA | 76.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.44 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|