C20H26N4O2 — CID 95716597
(3S)-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-(6-ethyl-2-methylpyrimidin-4-yl)piperidin-3-amine (PubChem CID 95716597) has the molecular formula C20H26N4O2 and a molecular weight of 354.45 g/mol. Its IUPAC name is (3S)-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-(6-ethyl-2-methylpyrimidin-4-yl)piperidin-3-amine.
| Compound Name | (3S)-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-(6-ethyl-2-methylpyrimidin-4-yl)piperidin-3-amine |
|---|---|
| PubChem CID | 95716597 |
| Molecular Formula | C20H26N4O2 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.21 |
| IUPAC Name | (3S)-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-(6-ethyl-2-methylpyrimidin-4-yl)piperidin-3-amine |
| SMILES | CCc1cc(N2CCC[C@H](Nc3ccc4c(c3)OCCO4)C2)nc(C)n1 |
| InChI | InChI=1S/C20H26N4O2/c1-3-15-12-20(22-14(2)21-15)24-8-4-5-17(13-24)23-16-6-7-18-19(11-16)26-10-9-25-18/h6-7,11-12,17,23H,3-5,8-10,13H2,1-2H3/t17-/m0/s1 |
| InChIKey | RGVDSXIHUNGHDA-KRWDZBQOSA-N |
| XLogP | 3.20 |
| TPSA | 59.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|