C19H24N4O2 — CID 95729456
(3S)-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-(5,6-dimethylpyrimidin-4-yl)piperidin-3-amine (PubChem CID 95729456) has the molecular formula C19H24N4O2 and a molecular weight of 340.43 g/mol. Its IUPAC name is (3S)-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-(5,6-dimethylpyrimidin-4-yl)piperidin-3-amine.
| Compound Name | (3S)-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-(5,6-dimethylpyrimidin-4-yl)piperidin-3-amine |
|---|---|
| PubChem CID | 95729456 |
| Molecular Formula | C19H24N4O2 |
| Molecular Weight | 340.43 g/mol |
| Exact Mass | 340.19 |
| IUPAC Name | (3S)-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-(5,6-dimethylpyrimidin-4-yl)piperidin-3-amine |
| SMILES | Cc1ncnc(N2CCC[C@H](Nc3ccc4c(c3)OCCO4)C2)c1C |
| InChI | InChI=1S/C19H24N4O2/c1-13-14(2)20-12-21-19(13)23-7-3-4-16(11-23)22-15-5-6-17-18(10-15)25-9-8-24-17/h5-6,10,12,16,22H,3-4,7-9,11H2,1-2H3/t16-/m0/s1 |
| InChIKey | QVOAPTUKQYILNR-INIZCTEOSA-N |
| XLogP | 2.95 |
| TPSA | 59.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.43 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|