C21H22N4O2 — CID 95726672
(3S)-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-quinoxalin-2-ylpiperidin-3-amine (PubChem CID 95726672) has the molecular formula C21H22N4O2 and a molecular weight of 362.43 g/mol. Its IUPAC name is (3S)-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-quinoxalin-2-ylpiperidin-3-amine.
| Compound Name | (3S)-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-quinoxalin-2-ylpiperidin-3-amine |
|---|---|
| PubChem CID | 95726672 |
| Molecular Formula | C21H22N4O2 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.17 |
| IUPAC Name | (3S)-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-quinoxalin-2-ylpiperidin-3-amine |
| SMILES | c1ccc2nc(N3CCC[C@H](Nc4ccc5c(c4)OCCO5)C3)cnc2c1 |
| InChI | InChI=1S/C21H22N4O2/c1-2-6-18-17(5-1)22-13-21(24-18)25-9-3-4-16(14-25)23-15-7-8-19-20(12-15)27-11-10-26-19/h1-2,5-8,12-13,16,23H,3-4,9-11,14H2/t16-/m0/s1 |
| InChIKey | LIOUPCDGCAVTKC-INIZCTEOSA-N |
| XLogP | 3.48 |
| TPSA | 59.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|