C18H24N4O — CID 95624715
4-[[(3R)-1-quinoxalin-2-ylpiperidin-3-yl]methyl]morpholine (PubChem CID 95624715) has the molecular formula C18H24N4O and a molecular weight of 312.42 g/mol. Its IUPAC name is 4-[[(3R)-1-quinoxalin-2-ylpiperidin-3-yl]methyl]morpholine.
| Compound Name | 4-[[(3R)-1-quinoxalin-2-ylpiperidin-3-yl]methyl]morpholine |
|---|---|
| PubChem CID | 95624715 |
| Molecular Formula | C18H24N4O |
| Molecular Weight | 312.42 g/mol |
| Exact Mass | 312.20 |
| IUPAC Name | 4-[[(3R)-1-quinoxalin-2-ylpiperidin-3-yl]methyl]morpholine |
| SMILES | c1ccc2nc(N3CCC[C@H](CN4CCOCC4)C3)cnc2c1 |
| InChI | InChI=1S/C18H24N4O/c1-2-6-17-16(5-1)19-12-18(20-17)22-7-3-4-15(14-22)13-21-8-10-23-11-9-21/h1-2,5-6,12,15H,3-4,7-11,13-14H2/t15-/m1/s1 |
| InChIKey | FKMALCLXJRGENJ-OAHLLOKOSA-N |
| XLogP | 2.18 |
| TPSA | 41.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.42 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |