About 4-[[(3R)-1-(2,3-dimethylquinolin-4-yl)piperidin-3-yl]methyl]morpholine
4-[[(3R)-1-(2,3-dimethylquinolin-4-yl)piperidin-3-yl]methyl]morpholine (PubChem CID 154755885) has the molecular formula C21H29N3O
and a molecular weight of 339.48 g/mol. Its IUPAC name is 4-[[(3R)-1-(2,3-dimethylquinolin-4-yl)piperidin-3-yl]methyl]morpholine.
Molecular Properties
| Compound Name | 4-[[(3R)-1-(2,3-dimethylquinolin-4-yl)piperidin-3-yl]methyl]morpholine |
| PubChem CID | 154755885 |
| Molecular Formula | C21H29N3O |
| Molecular Weight | 339.48 g/mol |
| Exact Mass | 339.23 |
| IUPAC Name | 4-[[(3R)-1-(2,3-dimethylquinolin-4-yl)piperidin-3-yl]methyl]morpholine |
| SMILES | Cc1nc2ccccc2c(N2CCC[C@H](CN3CCOCC3)C2)c1C |
| InChI | InChI=1S/C21H29N3O/c1-16-17(2)22-20-8-4-3-7-19(20)21(16)24-9-5-6-18(15-24)14-23-10-12-25-13-11-23/h3-4,7-8,18H,5-6,9-15H2,1-2H3/t18-/m1/s1 |
| InChIKey | MGOKQNCSIMVYDC-GOSISDBHSA-N |
| XLogP | 3.40 |
| TPSA | 28.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.48 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[[(3R)-1-(2,3-dimethylquinolin-4-yl)piperidin-3-yl]methyl]morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[(3R)-1-(2,3-dimethylquinolin-4-yl)piperidin-3-yl]methyl]morpholine?
The IUPAC name of 4-[[(3R)-1-(2,3-dimethylquinolin-4-yl)piperidin-3-yl]methyl]morpholine (CID 154755885) is 4-[[(3R)-1-(2,3-dimethylquinolin-4-yl)piperidin-3-yl]methyl]morpholine.
What is the SMILES notation for 4-[[(3R)-1-(2,3-dimethylquinolin-4-yl)piperidin-3-yl]methyl]morpholine?
The canonical SMILES for 4-[[(3R)-1-(2,3-dimethylquinolin-4-yl)piperidin-3-yl]methyl]morpholine is Cc1nc2ccccc2c(N2CCC[C@H](CN3CCOCC3)C2)c1C.
What is the InChIKey of 4-[[(3R)-1-(2,3-dimethylquinolin-4-yl)piperidin-3-yl]methyl]morpholine?
The InChIKey is MGOKQNCSIMVYDC-GOSISDBHSA-N. The full InChI is InChI=1S/C21H29N3O/c1-16-17(2)22-20-8-4-3-7-19(20)21(16)24-9-5-6-18(15-24)14-23-10-12-25-13-11-23/h3-4,7-8,18H,5-6,9-15H2,1-2H3/t18-/m1/s1.
What are the key properties of 4-[[(3R)-1-(2,3-dimethylquinolin-4-yl)piperidin-3-yl]methyl]morpholine?
4-[[(3R)-1-(2,3-dimethylquinolin-4-yl)piperidin-3-yl]methyl]morpholine has a molecular weight of 339.48 g/mol, XLogP of 3.40, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[(3R)-1-(2,3-dimethylquinolin-4-yl)piperidin-3-yl]methyl]morpholine is sourced from PubChem (CID 154755885), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).