C18H22N2 — CID 22021
9-piperidin-1-yl-1,2,3,4-tetrahydroacridine (PubChem CID 22021) has the molecular formula C18H22N2 and a molecular weight of 266.39 g/mol. Its IUPAC name is 9-piperidin-1-yl-1,2,3,4-tetrahydroacridine.
| Compound Name | 9-piperidin-1-yl-1,2,3,4-tetrahydroacridine |
|---|---|
| PubChem CID | 22021 |
| Molecular Formula | C18H22N2 |
| Molecular Weight | 266.39 g/mol |
| Exact Mass | 266.18 |
| IUPAC Name | 9-piperidin-1-yl-1,2,3,4-tetrahydroacridine |
| SMILES | c1ccc2c(N3CCCCC3)c3c(nc2c1)CCCC3 |
| InChI | InChI=1S/C18H22N2/c1-6-12-20(13-7-1)18-14-8-2-4-10-16(14)19-17-11-5-3-9-15(17)18/h2,4,8,10H,1,3,5-7,9,11-13H2 |
| InChIKey | PHKKNMUDCVZREA-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.39 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |