C16H17N5O — CID 94496992
3-methyl-5-[(3R)-1-quinoxalin-2-ylpiperidin-3-yl]-1,2,4-oxadiazole (PubChem CID 94496992) has the molecular formula C16H17N5O and a molecular weight of 295.35 g/mol. Its IUPAC name is 3-methyl-5-[(3R)-1-quinoxalin-2-ylpiperidin-3-yl]-1,2,4-oxadiazole.
| Compound Name | 3-methyl-5-[(3R)-1-quinoxalin-2-ylpiperidin-3-yl]-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 94496992 |
| Molecular Formula | C16H17N5O |
| Molecular Weight | 295.35 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | 3-methyl-5-[(3R)-1-quinoxalin-2-ylpiperidin-3-yl]-1,2,4-oxadiazole |
| SMILES | Cc1noc([C@@H]2CCCN(c3cnc4ccccc4n3)C2)n1 |
| InChI | InChI=1S/C16H17N5O/c1-11-18-16(22-20-11)12-5-4-8-21(10-12)15-9-17-13-6-2-3-7-14(13)19-15/h2-3,6-7,9,12H,4-5,8,10H2,1H3/t12-/m1/s1 |
| InChIKey | ZIJMAHQFMVVVQN-GFCCVEGCSA-N |
| XLogP | 2.71 |
| TPSA | 67.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.35 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |