C16H16N4S — CID 124883316
2-[(3S)-1-quinoxalin-2-ylpiperidin-3-yl]-1,3-thiazole (PubChem CID 124883316) has the molecular formula C16H16N4S and a molecular weight of 296.40 g/mol. Its IUPAC name is 2-[(3S)-1-quinoxalin-2-ylpiperidin-3-yl]-1,3-thiazole.
| Compound Name | 2-[(3S)-1-quinoxalin-2-ylpiperidin-3-yl]-1,3-thiazole |
|---|---|
| PubChem CID | 124883316 |
| Molecular Formula | C16H16N4S |
| Molecular Weight | 296.40 g/mol |
| Exact Mass | 296.11 |
| IUPAC Name | 2-[(3S)-1-quinoxalin-2-ylpiperidin-3-yl]-1,3-thiazole |
| SMILES | c1ccc2nc(N3CCC[C@H](c4nccs4)C3)cnc2c1 |
| InChI | InChI=1S/C16H16N4S/c1-2-6-14-13(5-1)18-10-15(19-14)20-8-3-4-12(11-20)16-17-7-9-21-16/h1-2,5-7,9-10,12H,3-4,8,11H2/t12-/m0/s1 |
| InChIKey | QADJGQVSIOZQFR-LBPRGKRZSA-N |
| XLogP | 3.47 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.40 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |