C16H18N6 — CID 146045794
2-[3-(5-methyl-1H-1,2,4-triazol-3-yl)piperidin-1-yl]quinoxaline (PubChem CID 146045794) has the molecular formula C16H18N6 and a molecular weight of 294.36 g/mol. Its IUPAC name is 2-[3-(5-methyl-1H-1,2,4-triazol-3-yl)piperidin-1-yl]quinoxaline.
| Compound Name | 2-[3-(5-methyl-1H-1,2,4-triazol-3-yl)piperidin-1-yl]quinoxaline |
|---|---|
| PubChem CID | 146045794 |
| Molecular Formula | C16H18N6 |
| Molecular Weight | 294.36 g/mol |
| Exact Mass | 294.16 |
| IUPAC Name | 2-[3-(5-methyl-1H-1,2,4-triazol-3-yl)piperidin-1-yl]quinoxaline |
| SMILES | Cc1nc(C2CCCN(c3cnc4ccccc4n3)C2)n[nH]1 |
| InChI | InChI=1S/C16H18N6/c1-11-18-16(21-20-11)12-5-4-8-22(10-12)15-9-17-13-6-2-3-7-14(13)19-15/h2-3,6-7,9,12H,4-5,8,10H2,1H3,(H,18,20,21) |
| InChIKey | FVQVBUGXHXBSDO-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.36 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |