C15H18N4 — CID 98763151
2-[(8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]quinoxaline (PubChem CID 98763151) has the molecular formula C15H18N4 and a molecular weight of 254.34 g/mol. Its IUPAC name is 2-[(8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]quinoxaline.
| Compound Name | 2-[(8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]quinoxaline |
|---|---|
| PubChem CID | 98763151 |
| Molecular Formula | C15H18N4 |
| Molecular Weight | 254.34 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | 2-[(8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]quinoxaline |
| SMILES | c1ccc2nc(N3CCN4CCC[C@H]4C3)cnc2c1 |
| InChI | InChI=1S/C15H18N4/c1-2-6-14-13(5-1)16-10-15(17-14)19-9-8-18-7-3-4-12(18)11-19/h1-2,5-6,10,12H,3-4,7-9,11H2/t12-/m0/s1 |
| InChIKey | QGKZYSFHCJGDSU-LBPRGKRZSA-N |
| XLogP | 1.91 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.34 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |