C18H24N4O2 — CID 25289632
(3S)-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-[(1-methylpyrazol-4-yl)methyl]piperidin-3-amine (PubChem CID 25289632) has the molecular formula C18H24N4O2 and a molecular weight of 328.42 g/mol. Its IUPAC name is (3S)-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-[(1-methylpyrazol-4-yl)methyl]piperidin-3-amine.
| Compound Name | (3S)-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-[(1-methylpyrazol-4-yl)methyl]piperidin-3-amine |
|---|---|
| PubChem CID | 25289632 |
| Molecular Formula | C18H24N4O2 |
| Molecular Weight | 328.42 g/mol |
| Exact Mass | 328.19 |
| IUPAC Name | (3S)-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-[(1-methylpyrazol-4-yl)methyl]piperidin-3-amine |
| SMILES | Cn1cc(CN2CCC[C@H](Nc3ccc4c(c3)OCCO4)C2)cn1 |
| InChI | InChI=1S/C18H24N4O2/c1-21-11-14(10-19-21)12-22-6-2-3-16(13-22)20-15-4-5-17-18(9-15)24-8-7-23-17/h4-5,9-11,16,20H,2-3,6-8,12-13H2,1H3/t16-/m0/s1 |
| InChIKey | HDIZTPLFPIUJGO-INIZCTEOSA-N |
| XLogP | 2.27 |
| TPSA | 51.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.42 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|