C24H26N4O2 — CID 42521884
(3R)-N-(1,3-benzodioxol-5-yl)-1-[[2-(2-methylphenyl)pyrimidin-5-yl]methyl]piperidin-3-amine (PubChem CID 42521884) has the molecular formula C24H26N4O2 and a molecular weight of 402.50 g/mol. Its IUPAC name is (3R)-N-(1,3-benzodioxol-5-yl)-1-[[2-(2-methylphenyl)pyrimidin-5-yl]methyl]piperidin-3-amine.
| Compound Name | (3R)-N-(1,3-benzodioxol-5-yl)-1-[[2-(2-methylphenyl)pyrimidin-5-yl]methyl]piperidin-3-amine |
|---|---|
| PubChem CID | 42521884 |
| Molecular Formula | C24H26N4O2 |
| Molecular Weight | 402.50 g/mol |
| Exact Mass | 402.21 |
| IUPAC Name | (3R)-N-(1,3-benzodioxol-5-yl)-1-[[2-(2-methylphenyl)pyrimidin-5-yl]methyl]piperidin-3-amine |
| SMILES | Cc1ccccc1-c1ncc(CN2CCC[C@@H](Nc3ccc4c(c3)OCO4)C2)cn1 |
| InChI | InChI=1S/C24H26N4O2/c1-17-5-2-3-7-21(17)24-25-12-18(13-26-24)14-28-10-4-6-20(15-28)27-19-8-9-22-23(11-19)30-16-29-22/h2-3,5,7-9,11-13,20,27H,4,6,10,14-16H2,1H3/t20-/m1/s1 |
| InChIKey | LMSVFGGLCPKEQL-HXUWFJFHSA-N |
| XLogP | 4.26 |
| TPSA | 59.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.50 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|