C21H25ClN2O4 — CID 42526335
5-chloro-4-[[(3R)-3-(2,3-dihydro-1,4-benzodioxin-6-ylamino)piperidin-1-yl]methyl]-2-methoxyphenol (PubChem CID 42526335) has the molecular formula C21H25ClN2O4 and a molecular weight of 404.89 g/mol. Its IUPAC name is 5-chloro-4-[[(3R)-3-(2,3-dihydro-1,4-benzodioxin-6-ylamino)piperidin-1-yl]methyl]-2-methoxyphenol.
| Compound Name | 5-chloro-4-[[(3R)-3-(2,3-dihydro-1,4-benzodioxin-6-ylamino)piperidin-1-yl]methyl]-2-methoxyphenol |
|---|---|
| PubChem CID | 42526335 |
| Molecular Formula | C21H25ClN2O4 |
| Molecular Weight | 404.89 g/mol |
| Exact Mass | 404.15 |
| IUPAC Name | 5-chloro-4-[[(3R)-3-(2,3-dihydro-1,4-benzodioxin-6-ylamino)piperidin-1-yl]methyl]-2-methoxyphenol |
| SMILES | COc1cc(CN2CCC[C@@H](Nc3ccc4c(c3)OCCO4)C2)c(Cl)cc1O |
| InChI | InChI=1S/C21H25ClN2O4/c1-26-20-9-14(17(22)11-18(20)25)12-24-6-2-3-16(13-24)23-15-4-5-19-21(10-15)28-8-7-27-19/h4-5,9-11,16,23,25H,2-3,6-8,12-13H2,1H3/t16-/m1/s1 |
| InChIKey | CUBVILDEQDDLDY-MRXNPFEDSA-N |
| XLogP | 3.90 |
| TPSA | 63.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.89 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|