C20H28N4O3 — CID 95730315
(3S)-1-[(5-tert-butyl-1,2,4-oxadiazol-3-yl)methyl]-N-(2,3-dihydro-1,4-benzodioxin-6-yl)piperidin-3-amine (PubChem CID 95730315) has the molecular formula C20H28N4O3 and a molecular weight of 372.47 g/mol. Its IUPAC name is (3S)-1-[(5-tert-butyl-1,2,4-oxadiazol-3-yl)methyl]-N-(2,3-dihydro-1,4-benzodioxin-6-yl)piperidin-3-amine.
| Compound Name | (3S)-1-[(5-tert-butyl-1,2,4-oxadiazol-3-yl)methyl]-N-(2,3-dihydro-1,4-benzodioxin-6-yl)piperidin-3-amine |
|---|---|
| PubChem CID | 95730315 |
| Molecular Formula | C20H28N4O3 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.22 |
| IUPAC Name | (3S)-1-[(5-tert-butyl-1,2,4-oxadiazol-3-yl)methyl]-N-(2,3-dihydro-1,4-benzodioxin-6-yl)piperidin-3-amine |
| SMILES | CC(C)(C)c1nc(CN2CCC[C@H](Nc3ccc4c(c3)OCCO4)C2)no1 |
| InChI | InChI=1S/C20H28N4O3/c1-20(2,3)19-22-18(23-27-19)13-24-8-4-5-15(12-24)21-14-6-7-16-17(11-14)26-10-9-25-16/h6-7,11,15,21H,4-5,8-10,12-13H2,1-3H3/t15-/m0/s1 |
| InChIKey | CVEJXILRQSDEGC-HNNXBMFYSA-N |
| XLogP | 3.21 |
| TPSA | 72.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|