C18H23N3O5S — CID 42521374
(3S)-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]piperidin-3-amine (PubChem CID 42521374) has the molecular formula C18H23N3O5S and a molecular weight of 393.47 g/mol. Its IUPAC name is (3S)-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]piperidin-3-amine.
| Compound Name | (3S)-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]piperidin-3-amine |
|---|---|
| PubChem CID | 42521374 |
| Molecular Formula | C18H23N3O5S |
| Molecular Weight | 393.47 g/mol |
| Exact Mass | 393.14 |
| IUPAC Name | (3S)-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]piperidin-3-amine |
| SMILES | Cc1noc(C)c1S(=O)(=O)N1CCC[C@H](Nc2ccc3c(c2)OCCO3)C1 |
| InChI | InChI=1S/C18H23N3O5S/c1-12-18(13(2)26-20-12)27(22,23)21-7-3-4-15(11-21)19-14-5-6-16-17(10-14)25-9-8-24-16/h5-6,10,15,19H,3-4,7-9,11H2,1-2H3/t15-/m0/s1 |
| InChIKey | QFKWTOVISSUALR-HNNXBMFYSA-N |
| XLogP | 2.33 |
| TPSA | 93.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.47 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|