C23H25FN4 — CID 25382358
(3S)-N-(4-fluorophenyl)-1-[[2-(2-methylphenyl)pyrimidin-5-yl]methyl]piperidin-3-amine (PubChem CID 25382358) has the molecular formula C23H25FN4 and a molecular weight of 376.48 g/mol. Its IUPAC name is (3S)-N-(4-fluorophenyl)-1-[[2-(2-methylphenyl)pyrimidin-5-yl]methyl]piperidin-3-amine.
| Compound Name | (3S)-N-(4-fluorophenyl)-1-[[2-(2-methylphenyl)pyrimidin-5-yl]methyl]piperidin-3-amine |
|---|---|
| PubChem CID | 25382358 |
| Molecular Formula | C23H25FN4 |
| Molecular Weight | 376.48 g/mol |
| Exact Mass | 376.21 |
| IUPAC Name | (3S)-N-(4-fluorophenyl)-1-[[2-(2-methylphenyl)pyrimidin-5-yl]methyl]piperidin-3-amine |
| SMILES | Cc1ccccc1-c1ncc(CN2CCC[C@H](Nc3ccc(F)cc3)C2)cn1 |
| InChI | InChI=1S/C23H25FN4/c1-17-5-2-3-7-22(17)23-25-13-18(14-26-23)15-28-12-4-6-21(16-28)27-20-10-8-19(24)9-11-20/h2-3,5,7-11,13-14,21,27H,4,6,12,15-16H2,1H3/t21-/m0/s1 |
| InChIKey | QVOPCOAJHKBAGE-NRFANRHFSA-N |
| XLogP | 4.67 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.48 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |