C20H24N2O2 — CID 118997215
1-benzyl-N-(2,3-dihydro-1,4-benzodioxin-6-yl)piperidin-4-amine (PubChem CID 118997215) has the molecular formula C20H24N2O2 and a molecular weight of 324.42 g/mol. Its IUPAC name is 1-benzyl-N-(2,3-dihydro-1,4-benzodioxin-6-yl)piperidin-4-amine.
| Compound Name | 1-benzyl-N-(2,3-dihydro-1,4-benzodioxin-6-yl)piperidin-4-amine |
|---|---|
| PubChem CID | 118997215 |
| Molecular Formula | C20H24N2O2 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.18 |
| IUPAC Name | 1-benzyl-N-(2,3-dihydro-1,4-benzodioxin-6-yl)piperidin-4-amine |
| SMILES | c1ccc(CN2CCC(Nc3ccc4c(c3)OCCO4)CC2)cc1 |
| InChI | InChI=1S/C20H24N2O2/c1-2-4-16(5-3-1)15-22-10-8-17(9-11-22)21-18-6-7-19-20(14-18)24-13-12-23-19/h1-7,14,17,21H,8-13,15H2 |
| InChIKey | ADBNAUQRSMRBQP-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|