C19H22ClN5O2 — CID 42376894
1-[4-[(3-chlorobenzoyl)amino]cyclohexyl]-N-cyclopropyltriazole-4-carboxamide (PubChem CID 42376894) has the molecular formula C19H22ClN5O2 and a molecular weight of 387.87 g/mol. Its IUPAC name is 1-[4-[(3-chlorobenzoyl)amino]cyclohexyl]-N-cyclopropyltriazole-4-carboxamide.
| Compound Name | 1-[4-[(3-chlorobenzoyl)amino]cyclohexyl]-N-cyclopropyltriazole-4-carboxamide |
|---|---|
| PubChem CID | 42376894 |
| Molecular Formula | C19H22ClN5O2 |
| Molecular Weight | 387.87 g/mol |
| Exact Mass | 387.15 |
| IUPAC Name | 1-[4-[(3-chlorobenzoyl)amino]cyclohexyl]-N-cyclopropyltriazole-4-carboxamide |
| SMILES | O=C(NC1CCC(n2cc(C(=O)NC3CC3)nn2)CC1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C19H22ClN5O2/c20-13-3-1-2-12(10-13)18(26)21-15-6-8-16(9-7-15)25-11-17(23-24-25)19(27)22-14-4-5-14/h1-3,10-11,14-16H,4-9H2,(H,21,26)(H,22,27) |
| InChIKey | WRXWXWBVBQNJJX-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.87 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |