C19H24ClN5O2 — CID 42398197
[1-[1-[(5-chloro-2-hydroxyphenyl)methyl]piperidin-4-yl]triazol-4-yl]-pyrrolidin-1-ylmethanone (PubChem CID 42398197) has the molecular formula C19H24ClN5O2 and a molecular weight of 389.89 g/mol. Its IUPAC name is [1-[1-[(5-chloro-2-hydroxyphenyl)methyl]piperidin-4-yl]triazol-4-yl]-pyrrolidin-1-ylmethanone.
| Compound Name | [1-[1-[(5-chloro-2-hydroxyphenyl)methyl]piperidin-4-yl]triazol-4-yl]-pyrrolidin-1-ylmethanone |
|---|---|
| PubChem CID | 42398197 |
| Molecular Formula | C19H24ClN5O2 |
| Molecular Weight | 389.89 g/mol |
| Exact Mass | 389.16 |
| IUPAC Name | [1-[1-[(5-chloro-2-hydroxyphenyl)methyl]piperidin-4-yl]triazol-4-yl]-pyrrolidin-1-ylmethanone |
| SMILES | O=C(c1cn(C2CCN(Cc3cc(Cl)ccc3O)CC2)nn1)N1CCCC1 |
| InChI | InChI=1S/C19H24ClN5O2/c20-15-3-4-18(26)14(11-15)12-23-9-5-16(6-10-23)25-13-17(21-22-25)19(27)24-7-1-2-8-24/h3-4,11,13,16,26H,1-2,5-10,12H2 |
| InChIKey | HTGRTUQGAUOFLB-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 74.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.89 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|