C19H26ClN5O2 — CID 42324185
1-[4-[(5-chloro-2-hydroxyphenyl)methylamino]cyclohexyl]-N-propan-2-yltriazole-4-carboxamide (PubChem CID 42324185) has the molecular formula C19H26ClN5O2 and a molecular weight of 391.90 g/mol. Its IUPAC name is 1-[4-[(5-chloro-2-hydroxyphenyl)methylamino]cyclohexyl]-N-propan-2-yltriazole-4-carboxamide.
| Compound Name | 1-[4-[(5-chloro-2-hydroxyphenyl)methylamino]cyclohexyl]-N-propan-2-yltriazole-4-carboxamide |
|---|---|
| PubChem CID | 42324185 |
| Molecular Formula | C19H26ClN5O2 |
| Molecular Weight | 391.90 g/mol |
| Exact Mass | 391.18 |
| IUPAC Name | 1-[4-[(5-chloro-2-hydroxyphenyl)methylamino]cyclohexyl]-N-propan-2-yltriazole-4-carboxamide |
| SMILES | CC(C)NC(=O)c1cn(C2CCC(NCc3cc(Cl)ccc3O)CC2)nn1 |
| InChI | InChI=1S/C19H26ClN5O2/c1-12(2)22-19(27)17-11-25(24-23-17)16-6-4-15(5-7-16)21-10-13-9-14(20)3-8-18(13)26/h3,8-9,11-12,15-16,21,26H,4-7,10H2,1-2H3,(H,22,27) |
| InChIKey | BWRZYWATTZTBCQ-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 92.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.90 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|