C19H27N5O2 — CID 26399029
N,N-diethyl-1-[1-[(2-hydroxyphenyl)methyl]piperidin-4-yl]triazole-4-carboxamide (PubChem CID 26399029) has the molecular formula C19H27N5O2 and a molecular weight of 357.46 g/mol. Its IUPAC name is N,N-diethyl-1-[1-[(2-hydroxyphenyl)methyl]piperidin-4-yl]triazole-4-carboxamide.
| Compound Name | N,N-diethyl-1-[1-[(2-hydroxyphenyl)methyl]piperidin-4-yl]triazole-4-carboxamide |
|---|---|
| PubChem CID | 26399029 |
| Molecular Formula | C19H27N5O2 |
| Molecular Weight | 357.46 g/mol |
| Exact Mass | 357.22 |
| IUPAC Name | N,N-diethyl-1-[1-[(2-hydroxyphenyl)methyl]piperidin-4-yl]triazole-4-carboxamide |
| SMILES | CCN(CC)C(=O)c1cn(C2CCN(Cc3ccccc3O)CC2)nn1 |
| InChI | InChI=1S/C19H27N5O2/c1-3-23(4-2)19(26)17-14-24(21-20-17)16-9-11-22(12-10-16)13-15-7-5-6-8-18(15)25/h5-8,14,16,25H,3-4,9-13H2,1-2H3 |
| InChIKey | WFBPDRRYVXGJJI-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 74.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.46 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|