C20H29N5O3 — CID 45250697
N,N-diethyl-1-[1-[(2-hydroxy-4-methoxyphenyl)methyl]piperidin-3-yl]triazole-4-carboxamide (PubChem CID 45250697) has the molecular formula C20H29N5O3 and a molecular weight of 387.48 g/mol. Its IUPAC name is N,N-diethyl-1-[1-[(2-hydroxy-4-methoxyphenyl)methyl]piperidin-3-yl]triazole-4-carboxamide.
| Compound Name | N,N-diethyl-1-[1-[(2-hydroxy-4-methoxyphenyl)methyl]piperidin-3-yl]triazole-4-carboxamide |
|---|---|
| PubChem CID | 45250697 |
| Molecular Formula | C20H29N5O3 |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.23 |
| IUPAC Name | N,N-diethyl-1-[1-[(2-hydroxy-4-methoxyphenyl)methyl]piperidin-3-yl]triazole-4-carboxamide |
| SMILES | CCN(CC)C(=O)c1cn(C2CCCN(Cc3ccc(OC)cc3O)C2)nn1 |
| InChI | InChI=1S/C20H29N5O3/c1-4-24(5-2)20(27)18-14-25(22-21-18)16-7-6-10-23(13-16)12-15-8-9-17(28-3)11-19(15)26/h8-9,11,14,16,26H,4-7,10,12-13H2,1-3H3 |
| InChIKey | MRNZIEOABVBZHS-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 83.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|