C21H29N5O3 — CID 45244526
methyl 4-[[3-[4-(diethylcarbamoyl)triazol-1-yl]piperidin-1-yl]methyl]benzoate (PubChem CID 45244526) has the molecular formula C21H29N5O3 and a molecular weight of 399.50 g/mol. Its IUPAC name is methyl 4-[[3-[4-(diethylcarbamoyl)triazol-1-yl]piperidin-1-yl]methyl]benzoate.
| Compound Name | methyl 4-[[3-[4-(diethylcarbamoyl)triazol-1-yl]piperidin-1-yl]methyl]benzoate |
|---|---|
| PubChem CID | 45244526 |
| Molecular Formula | C21H29N5O3 |
| Molecular Weight | 399.50 g/mol |
| Exact Mass | 399.23 |
| IUPAC Name | methyl 4-[[3-[4-(diethylcarbamoyl)triazol-1-yl]piperidin-1-yl]methyl]benzoate |
| SMILES | CCN(CC)C(=O)c1cn(C2CCCN(Cc3ccc(C(=O)OC)cc3)C2)nn1 |
| InChI | InChI=1S/C21H29N5O3/c1-4-25(5-2)20(27)19-15-26(23-22-19)18-7-6-12-24(14-18)13-16-8-10-17(11-9-16)21(28)29-3/h8-11,15,18H,4-7,12-14H2,1-3H3 |
| InChIKey | MZKJMGICOIFGNX-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 80.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.50 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |