C23H26ClN3O3 — CID 41118330
ethyl 4-[[(2R)-2-(6-chloro-9H-carbazol-2-yl)propanoyl]amino]piperidine-1-carboxylate (PubChem CID 41118330) has the molecular formula C23H26ClN3O3 and a molecular weight of 427.93 g/mol. Its IUPAC name is ethyl 4-[[(2R)-2-(6-chloro-9H-carbazol-2-yl)propanoyl]amino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[[(2R)-2-(6-chloro-9H-carbazol-2-yl)propanoyl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 41118330 |
| Molecular Formula | C23H26ClN3O3 |
| Molecular Weight | 427.93 g/mol |
| Exact Mass | 427.17 |
| IUPAC Name | ethyl 4-[[(2R)-2-(6-chloro-9H-carbazol-2-yl)propanoyl]amino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(NC(=O)[C@H](C)c2ccc3c(c2)[nH]c2ccc(Cl)cc23)CC1 |
| InChI | InChI=1S/C23H26ClN3O3/c1-3-30-23(29)27-10-8-17(9-11-27)25-22(28)14(2)15-4-6-18-19-13-16(24)5-7-20(19)26-21(18)12-15/h4-7,12-14,17,26H,3,8-11H2,1-2H3,(H,25,28)/t14-/m1/s1 |
| InChIKey | YZVYZDDLYOXCMI-CQSZACIVSA-N |
| XLogP | 4.82 |
| TPSA | 74.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.93 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |