C16H19ClN2O2 — CID 84582484
ethyl 4-(5-chloro-1H-indol-2-yl)piperidine-1-carboxylate (PubChem CID 84582484) has the molecular formula C16H19ClN2O2 and a molecular weight of 306.79 g/mol. Its IUPAC name is ethyl 4-(5-chloro-1H-indol-2-yl)piperidine-1-carboxylate.
| Compound Name | ethyl 4-(5-chloro-1H-indol-2-yl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 84582484 |
| Molecular Formula | C16H19ClN2O2 |
| Molecular Weight | 306.79 g/mol |
| Exact Mass | 306.11 |
| IUPAC Name | ethyl 4-(5-chloro-1H-indol-2-yl)piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(c2cc3cc(Cl)ccc3[nH]2)CC1 |
| InChI | InChI=1S/C16H19ClN2O2/c1-2-21-16(20)19-7-5-11(6-8-19)15-10-12-9-13(17)3-4-14(12)18-15/h3-4,9-11,18H,2,5-8H2,1H3 |
| InChIKey | YZNUNACRPBWYJZ-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.79 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |