C16H17NO3 — CID 23559459
ethyl 6-formyl-2,3,4,9-tetrahydro-1H-carbazole-3-carboxylate (PubChem CID 23559459) has the molecular formula C16H17NO3 and a molecular weight of 271.32 g/mol. Its IUPAC name is ethyl 6-formyl-2,3,4,9-tetrahydro-1H-carbazole-3-carboxylate.
| Compound Name | ethyl 6-formyl-2,3,4,9-tetrahydro-1H-carbazole-3-carboxylate |
|---|---|
| PubChem CID | 23559459 |
| Molecular Formula | C16H17NO3 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | ethyl 6-formyl-2,3,4,9-tetrahydro-1H-carbazole-3-carboxylate |
| SMILES | CCOC(=O)C1CCc2[nH]c3ccc(C=O)cc3c2C1 |
| InChI | InChI=1S/C16H17NO3/c1-2-20-16(19)11-4-6-15-13(8-11)12-7-10(9-18)3-5-14(12)17-15/h3,5,7,9,11,17H,2,4,6,8H2,1H3 |
| InChIKey | WHJJPQXDBKBKIF-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 59.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|