C10H14N2O3 — CID 129009642
ethyl 3-oxo-1,2,4,5,6,7-hexahydroindazole-5-carboxylate (PubChem CID 129009642) has the molecular formula C10H14N2O3 and a molecular weight of 210.23 g/mol. Its IUPAC name is ethyl 3-oxo-1,2,4,5,6,7-hexahydroindazole-5-carboxylate.
| Compound Name | ethyl 3-oxo-1,2,4,5,6,7-hexahydroindazole-5-carboxylate |
|---|---|
| PubChem CID | 129009642 |
| Molecular Formula | C10H14N2O3 |
| Molecular Weight | 210.23 g/mol |
| Exact Mass | 210.10 |
| IUPAC Name | ethyl 3-oxo-1,2,4,5,6,7-hexahydroindazole-5-carboxylate |
| SMILES | CCOC(=O)C1CCc2[nH][nH]c(=O)c2C1 |
| InChI | InChI=1S/C10H14N2O3/c1-2-15-10(14)6-3-4-8-7(5-6)9(13)12-11-8/h6H,2-5H2,1H3,(H2,11,12,13) |
| InChIKey | WESIOPFYENBFOH-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 74.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.23 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |