C22H21ClN2O3 — CID 113203916
ethyl 4-[(6-chloro-2,3,4,9-tetrahydro-1H-carbazole-3-carbonyl)amino]benzoate (PubChem CID 113203916) has the molecular formula C22H21ClN2O3 and a molecular weight of 396.87 g/mol. Its IUPAC name is ethyl 4-[(6-chloro-2,3,4,9-tetrahydro-1H-carbazole-3-carbonyl)amino]benzoate.
| Compound Name | ethyl 4-[(6-chloro-2,3,4,9-tetrahydro-1H-carbazole-3-carbonyl)amino]benzoate |
|---|---|
| PubChem CID | 113203916 |
| Molecular Formula | C22H21ClN2O3 |
| Molecular Weight | 396.87 g/mol |
| Exact Mass | 396.12 |
| IUPAC Name | ethyl 4-[(6-chloro-2,3,4,9-tetrahydro-1H-carbazole-3-carbonyl)amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)C2CCc3[nH]c4ccc(Cl)cc4c3C2)cc1 |
| InChI | InChI=1S/C22H21ClN2O3/c1-2-28-22(27)13-3-7-16(8-4-13)24-21(26)14-5-9-19-17(11-14)18-12-15(23)6-10-20(18)25-19/h3-4,6-8,10,12,14,25H,2,5,9,11H2,1H3,(H,24,26) |
| InChIKey | SQOIFOCWUYQSIM-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.87 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|