C17H19ClN2O3S — CID 113203868
6-chloro-N-(1,1-dioxothiolan-3-yl)-2,3,4,9-tetrahydro-1H-carbazole-3-carboxamide (PubChem CID 113203868) has the molecular formula C17H19ClN2O3S and a molecular weight of 366.87 g/mol. Its IUPAC name is 6-chloro-N-(1,1-dioxothiolan-3-yl)-2,3,4,9-tetrahydro-1H-carbazole-3-carboxamide.
| Compound Name | 6-chloro-N-(1,1-dioxothiolan-3-yl)-2,3,4,9-tetrahydro-1H-carbazole-3-carboxamide |
|---|---|
| PubChem CID | 113203868 |
| Molecular Formula | C17H19ClN2O3S |
| Molecular Weight | 366.87 g/mol |
| Exact Mass | 366.08 |
| IUPAC Name | 6-chloro-N-(1,1-dioxothiolan-3-yl)-2,3,4,9-tetrahydro-1H-carbazole-3-carboxamide |
| SMILES | O=C(NC1CCS(=O)(=O)C1)C1CCc2[nH]c3ccc(Cl)cc3c2C1 |
| InChI | InChI=1S/C17H19ClN2O3S/c18-11-2-4-16-14(8-11)13-7-10(1-3-15(13)20-16)17(21)19-12-5-6-24(22,23)9-12/h2,4,8,10,12,20H,1,3,5-7,9H2,(H,19,21) |
| InChIKey | DTNLBWGGUAWQSL-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 79.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.87 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|