C17H21ClN2O — CID 113096950
N-(6-chloro-2,3,4,9-tetrahydro-1H-carbazol-3-yl)-3-methylbutanamide (PubChem CID 113096950) has the molecular formula C17H21ClN2O and a molecular weight of 304.82 g/mol. Its IUPAC name is N-(6-chloro-2,3,4,9-tetrahydro-1H-carbazol-3-yl)-3-methylbutanamide.
| Compound Name | N-(6-chloro-2,3,4,9-tetrahydro-1H-carbazol-3-yl)-3-methylbutanamide |
|---|---|
| PubChem CID | 113096950 |
| Molecular Formula | C17H21ClN2O |
| Molecular Weight | 304.82 g/mol |
| Exact Mass | 304.13 |
| IUPAC Name | N-(6-chloro-2,3,4,9-tetrahydro-1H-carbazol-3-yl)-3-methylbutanamide |
| SMILES | CC(C)CC(=O)NC1CCc2[nH]c3ccc(Cl)cc3c2C1 |
| InChI | InChI=1S/C17H21ClN2O/c1-10(2)7-17(21)19-12-4-6-16-14(9-12)13-8-11(18)3-5-15(13)20-16/h3,5,8,10,12,20H,4,6-7,9H2,1-2H3,(H,19,21) |
| InChIKey | RZOXRIHKAHWDKT-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.82 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|