C18H16ClN3O — CID 113096983
N-(6-chloro-2,3,4,9-tetrahydro-1H-carbazol-3-yl)pyridine-3-carboxamide (PubChem CID 113096983) has the molecular formula C18H16ClN3O and a molecular weight of 325.80 g/mol. Its IUPAC name is N-(6-chloro-2,3,4,9-tetrahydro-1H-carbazol-3-yl)pyridine-3-carboxamide.
| Compound Name | N-(6-chloro-2,3,4,9-tetrahydro-1H-carbazol-3-yl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 113096983 |
| Molecular Formula | C18H16ClN3O |
| Molecular Weight | 325.80 g/mol |
| Exact Mass | 325.10 |
| IUPAC Name | N-(6-chloro-2,3,4,9-tetrahydro-1H-carbazol-3-yl)pyridine-3-carboxamide |
| SMILES | O=C(NC1CCc2[nH]c3ccc(Cl)cc3c2C1)c1cccnc1 |
| InChI | InChI=1S/C18H16ClN3O/c19-12-3-5-16-14(8-12)15-9-13(4-6-17(15)22-16)21-18(23)11-2-1-7-20-10-11/h1-3,5,7-8,10,13,22H,4,6,9H2,(H,21,23) |
| InChIKey | PPMCEELXAMXDHW-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.80 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|