C21H21ClN6 — CID 166239576
6-chloro-N-[[1-(pyridin-3-ylmethyl)triazol-4-yl]methyl]-2,3,4,9-tetrahydro-1H-carbazol-3-amine (PubChem CID 166239576) has the molecular formula C21H21ClN6 and a molecular weight of 392.89 g/mol. Its IUPAC name is 6-chloro-N-[[1-(pyridin-3-ylmethyl)triazol-4-yl]methyl]-2,3,4,9-tetrahydro-1H-carbazol-3-amine.
| Compound Name | 6-chloro-N-[[1-(pyridin-3-ylmethyl)triazol-4-yl]methyl]-2,3,4,9-tetrahydro-1H-carbazol-3-amine |
|---|---|
| PubChem CID | 166239576 |
| Molecular Formula | C21H21ClN6 |
| Molecular Weight | 392.89 g/mol |
| Exact Mass | 392.15 |
| IUPAC Name | 6-chloro-N-[[1-(pyridin-3-ylmethyl)triazol-4-yl]methyl]-2,3,4,9-tetrahydro-1H-carbazol-3-amine |
| SMILES | Clc1ccc2[nH]c3c(c2c1)CC(NCc1cn(Cc2cccnc2)nn1)CC3 |
| InChI | InChI=1S/C21H21ClN6/c22-15-3-5-20-18(8-15)19-9-16(4-6-21(19)25-20)24-11-17-13-28(27-26-17)12-14-2-1-7-23-10-14/h1-3,5,7-8,10,13,16,24-25H,4,6,9,11-12H2 |
| InChIKey | HIYFDRYBUJRRLZ-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 71.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.89 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|