C13H13N7 — CID 99795955
N-[[1-(pyridin-3-ylmethyl)triazol-4-yl]methyl]pyrazin-2-amine (PubChem CID 99795955) has the molecular formula C13H13N7 and a molecular weight of 267.30 g/mol. Its IUPAC name is N-[[1-(pyridin-3-ylmethyl)triazol-4-yl]methyl]pyrazin-2-amine.
| Compound Name | N-[[1-(pyridin-3-ylmethyl)triazol-4-yl]methyl]pyrazin-2-amine |
|---|---|
| PubChem CID | 99795955 |
| Molecular Formula | C13H13N7 |
| Molecular Weight | 267.30 g/mol |
| Exact Mass | 267.12 |
| IUPAC Name | N-[[1-(pyridin-3-ylmethyl)triazol-4-yl]methyl]pyrazin-2-amine |
| SMILES | c1cncc(Cn2cc(CNc3cnccn3)nn2)c1 |
| InChI | InChI=1S/C13H13N7/c1-2-11(6-14-3-1)9-20-10-12(18-19-20)7-17-13-8-15-4-5-16-13/h1-6,8,10H,7,9H2,(H,16,17) |
| InChIKey | WZMAAUNYJXKOMX-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 81.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.30 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |