C21H26N6O2S — CID 155092217
3-[[4-[[4-[3-[(sulfinoamino)methyl]phenyl]piperidin-1-yl]methyl]triazol-1-yl]methyl]pyridine (PubChem CID 155092217) has the molecular formula C21H26N6O2S and a molecular weight of 426.55 g/mol. Its IUPAC name is 3-[[4-[[4-[3-[(sulfinoamino)methyl]phenyl]piperidin-1-yl]methyl]triazol-1-yl]methyl]pyridine.
| Compound Name | 3-[[4-[[4-[3-[(sulfinoamino)methyl]phenyl]piperidin-1-yl]methyl]triazol-1-yl]methyl]pyridine |
|---|---|
| PubChem CID | 155092217 |
| Molecular Formula | C21H26N6O2S |
| Molecular Weight | 426.55 g/mol |
| Exact Mass | 426.18 |
| IUPAC Name | 3-[[4-[[4-[3-[(sulfinoamino)methyl]phenyl]piperidin-1-yl]methyl]triazol-1-yl]methyl]pyridine |
| SMILES | O=S(O)NCc1cccc(C2CCN(Cc3cn(Cc4cccnc4)nn3)CC2)c1 |
| InChI | InChI=1S/C21H26N6O2S/c28-30(29)23-13-17-3-1-5-20(11-17)19-6-9-26(10-7-19)15-21-16-27(25-24-21)14-18-4-2-8-22-12-18/h1-5,8,11-12,16,19,23H,6-7,9-10,13-15H2,(H,28,29) |
| InChIKey | NYDQXXNOXYHSRK-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 96.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.55 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|