C21H28F2N5O2S- — CID 155092244
1-[[1-(4,4-difluorocyclohexyl)triazol-4-yl]methyl]-4-[3-[(sulfinatoamino)methyl]phenyl]piperidine (PubChem CID 155092244) has the molecular formula C21H28F2N5O2S- and a molecular weight of 452.55 g/mol. Its IUPAC name is 1-[[1-(4,4-difluorocyclohexyl)triazol-4-yl]methyl]-4-[3-[(sulfinatoamino)methyl]phenyl]piperidine.
| Compound Name | 1-[[1-(4,4-difluorocyclohexyl)triazol-4-yl]methyl]-4-[3-[(sulfinatoamino)methyl]phenyl]piperidine |
|---|---|
| PubChem CID | 155092244 |
| Molecular Formula | C21H28F2N5O2S- |
| Molecular Weight | 452.55 g/mol |
| Exact Mass | 452.19 |
| IUPAC Name | 1-[[1-(4,4-difluorocyclohexyl)triazol-4-yl]methyl]-4-[3-[(sulfinatoamino)methyl]phenyl]piperidine |
| SMILES | O=S([O-])NCc1cccc(C2CCN(Cc3cn(C4CCC(F)(F)CC4)nn3)CC2)c1 |
| InChI | InChI=1S/C21H29F2N5O2S/c22-21(23)8-4-20(5-9-21)28-15-19(25-26-28)14-27-10-6-17(7-11-27)18-3-1-2-16(12-18)13-24-31(29)30/h1-3,12,15,17,20,24H,4-11,13-14H2,(H,29,30)/p-1 |
| InChIKey | CJYPNKRAKQZJSQ-UHFFFAOYSA-M |
| XLogP | 3.29 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.55 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|