C22H28N6O2S — CID 155092253
2-[1-[4-[[4-[3-[(sulfinoamino)methyl]phenyl]piperidin-1-yl]methyl]triazol-1-yl]ethyl]pyridine (PubChem CID 155092253) has the molecular formula C22H28N6O2S and a molecular weight of 440.57 g/mol. Its IUPAC name is 2-[1-[4-[[4-[3-[(sulfinoamino)methyl]phenyl]piperidin-1-yl]methyl]triazol-1-yl]ethyl]pyridine.
| Compound Name | 2-[1-[4-[[4-[3-[(sulfinoamino)methyl]phenyl]piperidin-1-yl]methyl]triazol-1-yl]ethyl]pyridine |
|---|---|
| PubChem CID | 155092253 |
| Molecular Formula | C22H28N6O2S |
| Molecular Weight | 440.57 g/mol |
| Exact Mass | 440.20 |
| IUPAC Name | 2-[1-[4-[[4-[3-[(sulfinoamino)methyl]phenyl]piperidin-1-yl]methyl]triazol-1-yl]ethyl]pyridine |
| SMILES | CC(c1ccccn1)n1cc(CN2CCC(c3cccc(CNS(=O)O)c3)CC2)nn1 |
| InChI | InChI=1S/C22H28N6O2S/c1-17(22-7-2-3-10-23-22)28-16-21(25-26-28)15-27-11-8-19(9-12-27)20-6-4-5-18(13-20)14-24-31(29)30/h2-7,10,13,16-17,19,24H,8-9,11-12,14-15H2,1H3,(H,29,30) |
| InChIKey | LURWHPITDSAOGL-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 96.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.57 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|