C24H33N5O2S — CID 155107496
N-[3-[1-[[1-[(2E,4Z)-hepta-2,4,6-trien-3-yl]triazol-4-yl]methyl]piperidin-4-yl]phenyl]propane-2-sulfonamide (PubChem CID 155107496) has the molecular formula C24H33N5O2S and a molecular weight of 455.63 g/mol. Its IUPAC name is N-[3-[1-[[1-[(2E,4Z)-hepta-2,4,6-trien-3-yl]triazol-4-yl]methyl]piperidin-4-yl]phenyl]propane-2-sulfonamide.
| Compound Name | N-[3-[1-[[1-[(2E,4Z)-hepta-2,4,6-trien-3-yl]triazol-4-yl]methyl]piperidin-4-yl]phenyl]propane-2-sulfonamide |
|---|---|
| PubChem CID | 155107496 |
| Molecular Formula | C24H33N5O2S |
| Molecular Weight | 455.63 g/mol |
| Exact Mass | 455.24 |
| IUPAC Name | N-[3-[1-[[1-[(2E,4Z)-hepta-2,4,6-trien-3-yl]triazol-4-yl]methyl]piperidin-4-yl]phenyl]propane-2-sulfonamide |
| SMILES | C=C/C=C\C(=C/C)n1cc(CN2CCC(c3cccc(NS(=O)(=O)C(C)C)c3)CC2)nn1 |
| InChI | InChI=1S/C24H33N5O2S/c1-5-7-11-24(6-2)29-18-23(25-27-29)17-28-14-12-20(13-15-28)21-9-8-10-22(16-21)26-32(30,31)19(3)4/h5-11,16,18-20,26H,1,12-15,17H2,2-4H3/b11-7-,24-6+ |
| InChIKey | LNGLQHZTIUCKIY-PPJFRECZSA-N |
| XLogP | 4.41 |
| TPSA | 80.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.63 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|