C24H30FN5O2S — CID 118173528
N-[3-[1-[[1-[(6-fluoro-2-pyridinyl)methyl]pyrazol-4-yl]methyl]piperidin-4-yl]phenyl]propane-2-sulfonamide (PubChem CID 118173528) has the molecular formula C24H30FN5O2S and a molecular weight of 471.60 g/mol. Its IUPAC name is N-[3-[1-[[1-[(6-fluoro-2-pyridinyl)methyl]pyrazol-4-yl]methyl]piperidin-4-yl]phenyl]propane-2-sulfonamide.
| Compound Name | N-[3-[1-[[1-[(6-fluoro-2-pyridinyl)methyl]pyrazol-4-yl]methyl]piperidin-4-yl]phenyl]propane-2-sulfonamide |
|---|---|
| PubChem CID | 118173528 |
| Molecular Formula | C24H30FN5O2S |
| Molecular Weight | 471.60 g/mol |
| Exact Mass | 471.21 |
| IUPAC Name | N-[3-[1-[[1-[(6-fluoro-2-pyridinyl)methyl]pyrazol-4-yl]methyl]piperidin-4-yl]phenyl]propane-2-sulfonamide |
| SMILES | CC(C)S(=O)(=O)Nc1cccc(C2CCN(Cc3cnn(Cc4cccc(F)n4)c3)CC2)c1 |
| InChI | InChI=1S/C24H30FN5O2S/c1-18(2)33(31,32)28-22-6-3-5-21(13-22)20-9-11-29(12-10-20)15-19-14-26-30(16-19)17-23-7-4-8-24(25)27-23/h3-8,13-14,16,18,20,28H,9-12,15,17H2,1-2H3 |
| InChIKey | KNUUDVILFVLWNX-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 80.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.60 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|