C17H23FN4 — CID 120843387
1-[1-[[1-[(4-fluorophenyl)methyl]pyrazol-4-yl]methyl]pyrrolidin-3-yl]ethanamine (PubChem CID 120843387) has the molecular formula C17H23FN4 and a molecular weight of 302.40 g/mol. Its IUPAC name is 1-[1-[[1-[(4-fluorophenyl)methyl]pyrazol-4-yl]methyl]pyrrolidin-3-yl]ethanamine.
| Compound Name | 1-[1-[[1-[(4-fluorophenyl)methyl]pyrazol-4-yl]methyl]pyrrolidin-3-yl]ethanamine |
|---|---|
| PubChem CID | 120843387 |
| Molecular Formula | C17H23FN4 |
| Molecular Weight | 302.40 g/mol |
| Exact Mass | 302.19 |
| IUPAC Name | 1-[1-[[1-[(4-fluorophenyl)methyl]pyrazol-4-yl]methyl]pyrrolidin-3-yl]ethanamine |
| SMILES | CC(N)C1CCN(Cc2cnn(Cc3ccc(F)cc3)c2)C1 |
| InChI | InChI=1S/C17H23FN4/c1-13(19)16-6-7-21(12-16)9-15-8-20-22(11-15)10-14-2-4-17(18)5-3-14/h2-5,8,11,13,16H,6-7,9-10,12,19H2,1H3 |
| InChIKey | NJUQFAUPVQWRBG-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 47.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.40 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |