C15H20ClFN4 — CID 120837476
1-[[1-[(4-fluorophenyl)methyl]pyrazol-4-yl]methyl]pyrrolidin-3-amine;hydrochloride (PubChem CID 120837476) has the molecular formula C15H20ClFN4 and a molecular weight of 310.80 g/mol. Its IUPAC name is 1-[[1-[(4-fluorophenyl)methyl]pyrazol-4-yl]methyl]pyrrolidin-3-amine;hydrochloride.
| Compound Name | 1-[[1-[(4-fluorophenyl)methyl]pyrazol-4-yl]methyl]pyrrolidin-3-amine;hydrochloride |
|---|---|
| PubChem CID | 120837476 |
| Molecular Formula | C15H20ClFN4 |
| Molecular Weight | 310.80 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | 1-[[1-[(4-fluorophenyl)methyl]pyrazol-4-yl]methyl]pyrrolidin-3-amine;hydrochloride |
| SMILES | Cl.NC1CCN(Cc2cnn(Cc3ccc(F)cc3)c2)C1 |
| InChI | InChI=1S/C15H19FN4.ClH/c16-14-3-1-12(2-4-14)9-20-10-13(7-18-20)8-19-6-5-15(17)11-19;/h1-4,7,10,15H,5-6,8-9,11,17H2;1H |
| InChIKey | YGCGHTJEHZEKCB-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 47.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.80 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |