C13H22Cl2N2 — CID 71741811
(1S)-1-[(3S)-1-benzylpyrrolidin-3-yl]ethanamine;dihydrochloride (PubChem CID 71741811) has the molecular formula C13H22Cl2N2 and a molecular weight of 277.24 g/mol. Its IUPAC name is (1S)-1-[(3S)-1-benzylpyrrolidin-3-yl]ethanamine;dihydrochloride.
| Compound Name | (1S)-1-[(3S)-1-benzylpyrrolidin-3-yl]ethanamine;dihydrochloride |
|---|---|
| PubChem CID | 71741811 |
| Molecular Formula | C13H22Cl2N2 |
| Molecular Weight | 277.24 g/mol |
| Exact Mass | 276.12 |
| IUPAC Name | (1S)-1-[(3S)-1-benzylpyrrolidin-3-yl]ethanamine;dihydrochloride |
| SMILES | C[C@H](N)[C@H]1CCN(Cc2ccccc2)C1.Cl.Cl |
| InChI | InChI=1S/C13H20N2.2ClH/c1-11(14)13-7-8-15(10-13)9-12-5-3-2-4-6-12;;/h2-6,11,13H,7-10,14H2,1H3;2*1H/t11-,13-;;/m0../s1 |
| InChIKey | ITNDAGFSBOVJQU-JBUFHSOLSA-N |
| XLogP | 2.70 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.24 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |