C20H22FN5O — CID 118173597
3-[1-[[1-[(6-fluoro-2-pyridinyl)methyl]triazol-4-yl]methyl]piperidin-4-yl]phenol (PubChem CID 118173597) has the molecular formula C20H22FN5O and a molecular weight of 367.43 g/mol. Its IUPAC name is 3-[1-[[1-[(6-fluoro-2-pyridinyl)methyl]triazol-4-yl]methyl]piperidin-4-yl]phenol.
| Compound Name | 3-[1-[[1-[(6-fluoro-2-pyridinyl)methyl]triazol-4-yl]methyl]piperidin-4-yl]phenol |
|---|---|
| PubChem CID | 118173597 |
| Molecular Formula | C20H22FN5O |
| Molecular Weight | 367.43 g/mol |
| Exact Mass | 367.18 |
| IUPAC Name | 3-[1-[[1-[(6-fluoro-2-pyridinyl)methyl]triazol-4-yl]methyl]piperidin-4-yl]phenol |
| SMILES | Oc1cccc(C2CCN(Cc3cn(Cc4cccc(F)n4)nn3)CC2)c1 |
| InChI | InChI=1S/C20H22FN5O/c21-20-6-2-4-17(22-20)13-26-14-18(23-24-26)12-25-9-7-15(8-10-25)16-3-1-5-19(27)11-16/h1-6,11,14-15,27H,7-10,12-13H2 |
| InChIKey | LTEADZAYQWUXGE-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.43 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|