C21H24FN5O — CID 118168648
3-fluoro-2-[[4-[[4-(3-methoxyphenyl)piperidin-1-yl]methyl]triazol-1-yl]methyl]pyridine (PubChem CID 118168648) has the molecular formula C21H24FN5O and a molecular weight of 381.46 g/mol. Its IUPAC name is 3-fluoro-2-[[4-[[4-(3-methoxyphenyl)piperidin-1-yl]methyl]triazol-1-yl]methyl]pyridine.
| Compound Name | 3-fluoro-2-[[4-[[4-(3-methoxyphenyl)piperidin-1-yl]methyl]triazol-1-yl]methyl]pyridine |
|---|---|
| PubChem CID | 118168648 |
| Molecular Formula | C21H24FN5O |
| Molecular Weight | 381.46 g/mol |
| Exact Mass | 381.20 |
| IUPAC Name | 3-fluoro-2-[[4-[[4-(3-methoxyphenyl)piperidin-1-yl]methyl]triazol-1-yl]methyl]pyridine |
| SMILES | COc1cccc(C2CCN(Cc3cn(Cc4ncccc4F)nn3)CC2)c1 |
| InChI | InChI=1S/C21H24FN5O/c1-28-19-5-2-4-17(12-19)16-7-10-26(11-8-16)13-18-14-27(25-24-18)15-21-20(22)6-3-9-23-21/h2-6,9,12,14,16H,7-8,10-11,13,15H2,1H3 |
| InChIKey | TZYFYZMKEWAXBL-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 56.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.46 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |