C25H32N6O2 — CID 118168611
[3-[1-[[1-(pyridin-2-ylmethyl)triazol-4-yl]methyl]piperidin-4-yl]phenyl] (2S)-2-amino-3-methylbutanoate (PubChem CID 118168611) has the molecular formula C25H32N6O2 and a molecular weight of 448.57 g/mol. Its IUPAC name is [3-[1-[[1-(pyridin-2-ylmethyl)triazol-4-yl]methyl]piperidin-4-yl]phenyl] (2S)-2-amino-3-methylbutanoate.
| Compound Name | [3-[1-[[1-(pyridin-2-ylmethyl)triazol-4-yl]methyl]piperidin-4-yl]phenyl] (2S)-2-amino-3-methylbutanoate |
|---|---|
| PubChem CID | 118168611 |
| Molecular Formula | C25H32N6O2 |
| Molecular Weight | 448.57 g/mol |
| Exact Mass | 448.26 |
| IUPAC Name | [3-[1-[[1-(pyridin-2-ylmethyl)triazol-4-yl]methyl]piperidin-4-yl]phenyl] (2S)-2-amino-3-methylbutanoate |
| SMILES | CC(C)[C@H](N)C(=O)Oc1cccc(C2CCN(Cc3cn(Cc4ccccn4)nn3)CC2)c1 |
| InChI | InChI=1S/C25H32N6O2/c1-18(2)24(26)25(32)33-23-8-5-6-20(14-23)19-9-12-30(13-10-19)15-22-17-31(29-28-22)16-21-7-3-4-11-27-21/h3-8,11,14,17-19,24H,9-10,12-13,15-16,26H2,1-2H3/t24-/m0/s1 |
| InChIKey | HGBAZBUSNRDKQK-DEOSSOPVSA-N |
| XLogP | 2.99 |
| TPSA | 99.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.57 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|