C17H17N3 — CID 117014262
2-(pyridin-3-ylmethyl)-1,3,4,5-tetrahydropyrido[4,3-b]indole (PubChem CID 117014262) has the molecular formula C17H17N3 and a molecular weight of 263.34 g/mol. Its IUPAC name is 2-(pyridin-3-ylmethyl)-1,3,4,5-tetrahydropyrido[4,3-b]indole.
| Compound Name | 2-(pyridin-3-ylmethyl)-1,3,4,5-tetrahydropyrido[4,3-b]indole |
|---|---|
| PubChem CID | 117014262 |
| Molecular Formula | C17H17N3 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.14 |
| IUPAC Name | 2-(pyridin-3-ylmethyl)-1,3,4,5-tetrahydropyrido[4,3-b]indole |
| SMILES | c1cncc(CN2CCc3[nH]c4ccccc4c3C2)c1 |
| InChI | InChI=1S/C17H17N3/c1-2-6-16-14(5-1)15-12-20(9-7-17(15)19-16)11-13-4-3-8-18-10-13/h1-6,8,10,19H,7,9,11-12H2 |
| InChIKey | UZYCLPQWWADBCS-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|