C19H20N2 — CID 13216318
2-benzyl-7-methyl-1,3,4,5-tetrahydropyrido[4,3-b]indole (PubChem CID 13216318) has the molecular formula C19H20N2 and a molecular weight of 276.38 g/mol. Its IUPAC name is 2-benzyl-7-methyl-1,3,4,5-tetrahydropyrido[4,3-b]indole.
| Compound Name | 2-benzyl-7-methyl-1,3,4,5-tetrahydropyrido[4,3-b]indole |
|---|---|
| PubChem CID | 13216318 |
| Molecular Formula | C19H20N2 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.16 |
| IUPAC Name | 2-benzyl-7-methyl-1,3,4,5-tetrahydropyrido[4,3-b]indole |
| SMILES | Cc1ccc2c3c([nH]c2c1)CCN(Cc1ccccc1)C3 |
| InChI | InChI=1S/C19H20N2/c1-14-7-8-16-17-13-21(12-15-5-3-2-4-6-15)10-9-18(17)20-19(16)11-14/h2-8,11,20H,9-10,12-13H2,1H3 |
| InChIKey | ZXOCXPUMDWJQQL-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 19.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|