C20H22N2 — CID 21231097
2-benzyl-6,9-dimethyl-1,3,4,5-tetrahydropyrido[4,3-b]indole (PubChem CID 21231097) has the molecular formula C20H22N2 and a molecular weight of 290.41 g/mol. Its IUPAC name is 2-benzyl-6,9-dimethyl-1,3,4,5-tetrahydropyrido[4,3-b]indole.
| Compound Name | 2-benzyl-6,9-dimethyl-1,3,4,5-tetrahydropyrido[4,3-b]indole |
|---|---|
| PubChem CID | 21231097 |
| Molecular Formula | C20H22N2 |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.18 |
| IUPAC Name | 2-benzyl-6,9-dimethyl-1,3,4,5-tetrahydropyrido[4,3-b]indole |
| SMILES | Cc1ccc(C)c2c3c([nH]c12)CCN(Cc1ccccc1)C3 |
| InChI | InChI=1S/C20H22N2/c1-14-8-9-15(2)20-19(14)17-13-22(11-10-18(17)21-20)12-16-6-4-3-5-7-16/h3-9,21H,10-13H2,1-2H3 |
| InChIKey | DLVBSJFJBXLIEZ-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 19.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |